DC Chemicals' products qualify for U.S. tariff exemptions. We guarantee no price increases due to customs duties and maintain stable supply, continuing to deliver reliable research solutions to our American clients.
| Cas No.: | 1312992-24-7 |
| Chemical Name: | DNQX disodium salt |
| SMILES: | O=C1[N-]C2=C(C=C([N+]([O-])=O)C([N+]([O-])=O)=C2)[N-]C1=O.[Na+].[Na+] |
| Formula: | C8H2N4Na2O6 |
| M.Wt: | 296.100 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | DNQX (FG 9041) disodium salt, a quinoxaline derivative, is a selective, potent competitive non-NMDA glutamate receptor antagonist (IC50s = 0.5, 2 and 40 μM for AMPA, kainate and NMDA receptors, respectively)[1]. |
| In Vivo: | DNQX (FG 9041), a specific AMPA receptor antagonist, given as either a 5 mg/kg or 10 mg/kg intraperitoneal dose or into the lateral cerebral ventricle (5 μl of 0.5 mg/ml) significantly diminishes phencyclidine (PCP) (40 mg/kg) and ketamine (80, 100, 120 mg/kg) hsp70 induction in the posterior cingulate and retrosplenial cortex[3]. |
| In Vitro: | DNQX (FG 9041) disodium salt selectively depolarizes thalamic reticular nucleus (TRN) neurons[2]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|