| Cas No.: | |
| Chemical Name: | Iso-A11B5C1 |
| Synonyms: | IsoA11B5C1 |
| SMILES: | CCCCCCCC/C=C\CCCCCCCCNC(=O)C(CCCCCOC(=O)CCC(C)CCCCC)NCCN1CCCC1 |
| Formula: | C41H79N3O3 |
| M.Wt: | 663.10 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Combinatorial design of ionizable lipid nanoparticles for muscle-selective mRNA delivery with minimized off-target effects--Proc Natl Acad Sci U S A. 2023 Dec 12;120(50):Jingan Chen ,Bowen Li |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
