| Cas No.: | 1443522-24-4 |
| Chemical Name: | L-369 |
| Synonyms: | L369, L 369,Lipid 369, Lipid369 |
| SMILES: | C(OCCC(CCCCC)CCCCC)(=O)CCCCCCCC(OC(=O)CCCN(C)C)CCCCCCCC(OCCC(CCCCC)CCCCC)=O |
| Formula: | C49H95N06 |
| M.Wt: | 794.28 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Jadhav, V., Vaishnaw, A., Fitzgerald, K., et al. RNA interference in the era of nucleic acid therapeutics. Nat. Biotechnol. 42(3), 394-405 (2024). |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
