DC Chemicals' products qualify for U.S. tariff exemptions. We guarantee no price increases due to customs duties and maintain stable supply, continuing to deliver reliable research solutions to our American clients.
| Cas No.: | 2158197-70-5 |
| Chemical Name: | 4-(4-Methylphenoxy)-7-(1-piperidin-4-ylpyrazol-4-yl)quinoline |
| Synonyms: | HS1371;7-(1-(piperidin-4-yl)-1h-pyrazol-4-yl)-4-(p-tolyloxy)quinoline;BCP30268;ZB1501;s8775;BDBM50246489;AK00898249;4-(4-Methylphenoxy)-7-(1-piperidin-4-ylpyrazol-4-yl)quinoline;HS-1371 |
| SMILES: | O(C1C([H])=C([H])C(C([H])([H])[H])=C([H])C=1[H])C1C([H])=C([H])N=C2C=1C([H])=C([H])C(=C2[H])C1C([H])=NN(C=1[H])C1([H])C([H])([H])C([H])([H])N([H])C([H])([H])C1([H])[H] |
| Formula: | C24H24N4O |
| M.Wt: | 384.4736 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | HS-1371 is a potent and ATP-competitive RIP3 inhibitor with an IC50 of 20.8 nM[1]. |
| In Vitro: | HS-1371 directly binds to RIP3 in an ATP-competitive and time-independent manner. HS-1371 has an inhibitory effect on RIP3 kinase activity in various cell lines[1]. HS-1371 can block RIP3 S227 phosphorylation[1]. HS-1371 rescues cells from RIP3-dependent necroptotic cell death but not apoptotic cell death[1]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|