| Cas No.: | 1346546-69-7 |
| Chemical Name: | Benzothiazol-5-yl-[6-(propane-2-sulfonyl)-quinolin-4-yl]-amine |
| Synonyms: | GSK-872,GSK 872,GSK872 |
| SMILES: | CC(C)S(=O)(=O)C1=CC2=C(C=CN=C2C=C1)NC3=CC4=C(C=C3)SC=N4 |
| Formula: | C19H17N3O2S2 |
| M.Wt: | 383.49 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | GSK'872 is a RIPK3 inhibitor, which binds RIP3 kinase domain with an IC50 of 1.8 nM, and inhibits kinase activity with an IC50 of 1.3 nM. |
| In Vitro: | GSK'872 blocks necroptosis in mouse cells. RIP3i GSK'872 inhibits TLR3- or DAI-induced death, two RIP1-independent pathways of necroptosis[1]. Pretreatment with GSK'872 (GSK-872) confers significant protection to primary hepatocytes. However, RIPK1 inhibition (by Nec1) does not impart any protection to primary hepatocytes[2]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|