| Cas No.: | 1165910-22-4 |
| Chemical Name: | LGD-4033 |
| Synonyms: | 4-((R)-2-((R)-2,2,2-Trifluoro-1-hydroxyethyl)pyrrolidin-1-yl)-2-(trifluoromethyl)benzonitrile;4-((R)-2-((R)-2,2,2-trifluoro-1-hydroxyethyl)pyrrolidin-1-yl)-2-trifluoromethyl)benzonitrile(LGD-4033);4-[(2R)-2-[(1R)-2,2,2-trifluoro-1-hydroxyethyl]pyrrolidin-1-yl]-2-(trifluoromethyl)benzonitrile;LGD4033;LGD-4033, ligandrol;LGD-4033,Anabolicum;LGD-4033 |
| SMILES: | N#CC1=CC=C(N2[C@@H]([C@@H](O)C(F)(F)F)CCC2)C=C1C(F)(F)F |
| Formula: | C14H12N2OF6 |
| M.Wt: | 338.24828 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | LGD-4033 is a novel nonsteroidal, oral SARM that binds to androgen receptor with high affinity (Ki of 1 nM) and selectivity. |
| In Vivo: | LGD-4033 has demonstrated anabolic activity in the muscle, anti-resorptive and anabolic activity in bone, and robust selectivity for muscle versus prostate In animal models. LGD-4033 is well tolerated, has a long elimination half-life and dose-proportional accumulation upon multiple dosing. LGD-4033 is safe, has favorable pharmacokinetic profile, and increases lean body mass even during this short period without change in prostate-specific antigen. |
| In Vitro: | LGD-4033, a novel nonsteroidal oral, selective androgen receptor modulator, binds androgen receptor with high affinity and selectivity.i |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|
| 2018-0101 |
|