| Cas No.: | 1951408-58-4 |
| Chemical Name: | EED inhibitor-1 |
| Synonyms: | MAK683;N-((5-fluoro-2,3-dihydrobenzofuran-4-yl)methyl)-8-(2-methylpyridin-3-yl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine;EED inhibitor-1;N-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methyl]-8-(2-methylpyridin-3-yl)-[1,2,4]triazolo[4,3-c]pyrimidin-5-amine;4K446Z8N51;MAK 683 [WHO-DD];US9580437, Example 2;GTPL10515;BDBM291687;BCP29116;example 2 [WO2016103155A1];A16922;FC=1C=CC2=C(CCO2)C=1CNC1=NC=C(C=2N1 |
| SMILES: | FC1C([H])=C([H])C2=C(C=1C([H])([H])N([H])C1=NC([H])=C(C3C([H])=C([H])C([H])=NC=3C([H])([H])[H])C3=NN=C([H])N13)C([H])([H])C([H])([H])O2 |
| Formula: | C20N6OFH17 |
| M.Wt: | 376.387 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | EED inhibitor-1 is an EED inhibitor extracted from patent US20160176882 A1, compound example 2; has IC50s of 59, 89, 26 nM in EED Alphascreen binding, LC-MS and ELISA assay. |
| Target: | IC50: 59 nM (EED Alphascreen), 89 nM (LC-MS), 26 nM (ELISA)[1] |
| In Vitro: | EED inhibitor-1 has antiproliferative activities in B cell lymphoma cell KARPAS422 after 14 days of treatment with an IC50 of 30 nM[1]. |
| References: | [1]. US20160176882 A1 |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|