| Cas No.: | 135575-42-7 |
| Chemical Name: | Pneumocandin B0 |
| Synonyms: | Pneumocandin B0;Pneumocardin B0;pneumocandin B(0);L-688786;PB0;B0 PneuMocandin B0;L 688786;pneumocandin Bo;1H-Dipyrrolo[2,1-c:2',1'-l][1,4,7,10,13,16]hexaazacycloheneicosine,cyclic peptide deriv.;L-Proline, (4R,5R)-N2-[(10R,12S)-10,12-dimethyl-1-oxotetradecyl]-4,5-dihydroxy-L-ornithyl-L-threonyl-(4R)-4-hydroxy-L-prolyl-(4S)-4-hydroxy-4-(4-hydroxyphenyl)-L-threonyl-(3R)-3-hydroxy-L-glutaminyl-3-hydroxy-,(6®1)-lactam, (3S)-;caspofungin intermediate;Caspofungin Pneumocandin B0 Impurity;N-[(3S,6S,11R,15S,18S,20R,21R,25S)-3-[(1R)-3-Amino-1-hydroxy-3-oxopropyl]-6-[(1S,2S)-1,2-dihydroxy-2 |
| SMILES: | CCC(C)CC(C)CCCCCCCCC(=O)N[C@@H]1C(=O)N[C@@H]([C@@H](C)O)C(=O)N2C(C[C@@H](O)C2)C(=O)N[C@@H]([C@H](O)[C@@H](O)C3=CC=C(O)C=C3)C(=O)N[C@@H]([C@H](O)CC(N)=O)C(=O)N4C(C(=O)N[C@H](O)[C@H](O)C1)[C@@H](O)CC4 |
| Formula: | C50H80N8O17 |
| M.Wt: | 1065.2136 |
| Purity: | >99% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Pneumocandin B0(L-688786), a key intermediate in the synthesis of the antifungal agent, Cancidas, has led to the identification of several materials with potential for improved performance. |
| References: | [1]. Welch CJ, et al. Preparation and evaluation of novel stationary phases for improved chromatographic purification of pneumocandin B0. J Chromatogr A. 2006 Jan 6;1101(1-2):204-13. [2]. Leonard WR Jr, et al. Synthesis of the antifungal beta-1,3-glucan synthase inhibitor CANCIDAS (caspofungin acetate) from pneumocandin B0. J Org Chem. 2007 Mar 30;72(7):2335-43. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|
| 2018-0101 |
|