| Cas No.: | 2254693-15-5 |
| Chemical Name: | SRX3207 |
| Synonyms: | SRX3207;SRX-3207;SRX 3207 |
| SMILES: | O=C1C2=C(C(C3=CC=C(NC4=NC=CC(N5N=C(C)C(CN6CCC6)=C5)=N4)C=C3)=CS2)OC(N7CCOCC7)=C1 |
| Formula: | C29H29N7O3S |
| M.Wt: | 555.65 |
| Sotrage: | Please store the product under the recommended conditions in the Certificate of Analysis. |
| Description: | SRX3207 is an orally active and first-in-class dual Syk/PI3K inhibitor. SRX3207 possesses anti-tumor activity[1]. |
| In Vivo: | SRX3207 (10 mg/kg, orally) increases antitumor immune response[1]. Animal Model: LLC or B16 or B16-OVA or CT26 (1 × 105) cells were injected subcutaneously into syngeneic mice[1]. Dosage: 10 mg/kg. Administration: Orally, starting from day 10 when tumors reached 100 mm3 until tumors were harvested on day 21. Result: Blocked phosphorylation of Syk at 348 site and Y525/526 site. Blocked immunosuppressive MΦ polarization. Blocked tumor growth and increased survival effectively. |
| In Vitro: | SRX3207 (10 μmol/L) is able to block p-AKT at concentration[1]. SRX3207 has sufficient solubility in water (43 μmol/L)[1]. |
| References: | [1]. Shweta Joshi, et al. Macrophage Syk–PI3Kγ Inhibits Antitumor Immunity: SRX3207, a Novel Dual Syk–PI3K Inhibitory Chemotype Relieves Tumor Immunosuppression. Molecular Cancer Therapeutics. 2020. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|
| 2018-0101 |
|