| Cas No.: | 129497-78-5 |
| Chemical Name: | Visudyne |
| Synonyms: | Visudyne |
| SMILES: | C[C@@]1(/C(N/2)=C/C(C(C)=C/3CCC(OC)=O)=NC3=C/C(N4)=C5CCC(O)=O)C(C2=CC(C(C)=C/6C=C)=NC6=C/C4=C5C)=CC=C(C(OC)=O)[C@@H]1C(OC)=O.C[C@@]7(/C(N/8)=C/C(C(C)=C/9CCC(O)=O)=NC9=C/C(N%10)=C%11CCC(OC)=O)C(C8=CC(C(C)=C/%12C=C)=NC%12=C/C%10=C%11C)=CC=C(C(OC)=O)[C@@H]7C |
| Formula: | C41H42N4O8 |
| M.Wt: | 718.79 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Verteporfin is a photosensitizer for photodynamic therapy to eliminate the abnormal blood vessels in the eye associated with conditions such as age-related macular degeneration. Verteporfin is a YAP inhibitor which disrupts YAP-TEAD interactions. |
| In Vivo: | Verteporfin (10 mg/kg, c.s.c.) and dasatinib significantly reduces the leukemia cell ratio, and combined therapy further reduced the number of leukemia cells in the spleen[1]. |
| In Vitro: | Verteporfin is specifically selected by PDX-cell screening. The concentrations to cause 50% growth inhibition (GI50) for PhLO, PhLH, and PhLK are 228 nM, 395 nM, and 538 nM, respectively, whereas GI50 for ALL-1, TCC-Y/sr, and NPhA1 are 3.93 µM, 2.11 µM, and 5.61 µM, respectively. GSH significantly reduces the sensitivity of 2 out of 3 PDX cells to verteporfin. Verteporfin reduces the mitochondrial membrane potential in PDX cells[1]. Verteporfin reduces the PTX-resistance on HCT-8/T cells by inhibiting YAP expression and combination therapy with verteporfin and paclitaxel (PTX) shows synergism on inhibition of YAP and cytotoxicity to HCT-8/T[2]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|