| Cas No.: | 65646-68-6 |
| Chemical Name: | Fenretinide |
| Synonyms: | Fenretinide;N-(4-Hydroxyphenyl)retinamide;Retinoic acid p-hydroxyanilide;all-trans-N-(4-Hydroxyphenyl)retinamide;4-HYDROXYPHENYLRETINAMIDE;Retinamide,N-(4-hydroxyphenyl)-;(4-Hydroxyphenyl)retinamide;4-HPR;Fenretinide(4-HPR);4-Hydroxyphenyl retinamide;all-trans-4'-Hydroxyretinanilide;Fenretinidum;Fenretinida;4-hydroxy(phenyl)retinamide;N-(4-Hydroxyphenyl)all-Trans Retinamide;Fenretinidum [Latin];Fenretinida [Spanish];4HPR;Retinoic acid p-hydroxyphenylamide;Fenretinide [USAN:INN];Retinamide, N-(4-hydroxyphenyl)-;4-(hydroxyphenyl)retinamide;15-[(4-hydroxyphenyl)amino]retinal;CC |
| SMILES: | O=C(/C(/[H])=C(\C([H])([H])[H])/C(/[H])=C(\[H])/C(/[H])=C(\C([H])([H])[H])/C(/[H])=C(\[H])/C1=C(C([H])([H])[H])C([H])([H])C([H])([H])C([H])([H])C1(C([H])([H])[H])C([H])([H])[H])N([H])C1C([H])=C([H])C(=C([H])C=1[H])O[H] |
| Formula: | C26H33NO2 |
| M.Wt: | 391.5457 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Fenretinide is a synthetic retinoid deriverative, binding to the retinoic acid receptors (RAR) at concentrations necessary to induce cell death. |
| In Vivo: | Fenretinide (10 mg/kg, i.p.) selectively inhibits ceramide accumulation HFD-fed male C57Bl/6 mice. Fenretinide treatment improves glucose tolerance and insulin sensitivity as determined by both glucose and insulin tolerance tests[2]. Addition of 25 mg/kg ketoconazole to Fenretinide in NOD/SCID mice increased 4-HPR plasma levels[3]. |
| In Vitro: | Fenretinide exerts not just acute but also long term antitumor activity in selected T-ALL cell lines. Fenretinide inhibits DES activity in CCRF-CEM leukemia cells in a dose and time dependent manner, leading to a concomitant increase of the endogenous cellular dhCer content. Fenretinide (3 μM)-induced dhCer accumulation in both CCRF-CEM and Jurkat cells[1]. Ceramide inhibition with fenretinide protects insulin signaling. Fenretinide prevents lipid-induced reductions in insulin-stimulated glucose uptake[2]. Fenretinide inhibits OVCAR-5 cell proliferation and viability at concentrations higher than 1 microM, with 70-90% growth inhibition at 10 microM. Fenretinide (1 microM) significantly inhibits OVCAR-5 invasion after 3 days preincubation. Endothelial cells treated with 1 microM 4-HPR fails to form tubes, but forms small cellular aggregates[4]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|