| Cas No.: | 1453097-13-6 |
| Chemical Name: | HUHS015 |
| Synonyms: | HUHS015 |
| SMILES: | OC1=C(CC2=CC=CC=C2)C(C)=NN1C3=NC4=CC=C(C)C=C4N3 |
| Formula: | C19H18N4O |
| M.Wt: | 318.372 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | HUHS015 is a potent PCA-1/ALKBH3 inhibitor both in vitro and in vivo. The bioavailability (BA) of HUHS015 was 7.2% in rats after oral administration. Continuously administering HUHS015 significantly suppressed the growth of DU145 cells, which are human hormone-independent prostate cancer cells, in a mouse xenograft model without untoward effects. [1] |
| References: | [1]. Nakao S et al. Design and synthesis of prostate cancer antigen-1 (PCA-1/ALKBH3) inhibitors as anti-prostate cancer drugs. Bioorg Med Chem Lett, 2014 Feb 15, 24(4):1071-4. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|