| Cas No.: | 161552-03-0 |
| Chemical Name: | Cyclo(-RGDfK) |
| Synonyms: | cyclo (Arg-Ala-Asp-d-Phe-Lys);2-[(2S,5R,8S,11S)-8-(4-aminobutyl)-5-benzyl-11-[3-(diaminomethylideneamino)propyl]-3,6,9,12,15-pentaoxo-1,4,7,10,13-pentazacyclopentadec-2-yl]acetic acid;c(RGDfK);cyclo (Arg-Gly-Asp-d-Phe-Lys),c(RGDfK);CYCLO (RGDFK);Cyclo (-RGDfK);Cyclo(-Arg-Gly-Asp-D-Phe-Lys);Cyclic RGDfK peptide;cyclo (Arg-Gly-Asp-d-Phe-Lys);Cyclo(RGDfK) peptide;Cyclo(L-arginylglycyl-L-alpha-aspartyl-D-phenylalanyl-L-lysyl);CYCLO(-RGDFK);cyclo (Arg-Gly-Asp-Phe-Lys);Cyclo(-Arg-Gly-Asp-D-Phe-Lys) Trifluoroacetate salt;Cyclo(-RGDfK) |
| SMILES: | O=C([C@H](CCCCN)NC([C@@H](CC1=CC=CC=C1)NC([C@H](CC(O)=O)NC(CN2)=O)=O)=O)N[C@@H](CCCNC(N)=N)C2=O |
| Formula: | C27H41N9O7 |
| M.Wt: | 603.67054 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | Cyclo(-RGDfK) is a potent and selective inhibitor of the αvβ3 integrin, with an IC50 of 0.94 nM. Sequence: Cyclo(Arg-Gly-Asp-Phe-Lys). |
| In Vitro: | Cyclo(-RGDfK) is a potent and selective inhibitor of the αvβ3 integrin, with a IC50 of 0.94 nM[1]. [(66)Ga]DOTA-E-[c(RGDfK)]2 can be prepared with high radiochemical purity (>97%), specific activity (36-67GBq/μM), in vitro stability, and moderate protein binding. MicroPET imaging up to 24 post-injection showed contrasting tumors reflecting αvβ3-targeted tracer accumulation[2]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|