| Cas No.: | 133413-70-4 |
| Chemical Name: | PF1022A; PF-1022A |
| Synonyms: | PF1022A; PF-1022A |
| SMILES: | O=C(N([C@H](C(O[C@](C(N([C@H](C(O[C@H](CC1=CC=CC=C1)C2=O)=O)CC(C)C)C)=O)([H])C)=O)CC(C)C)C)[C@H](OC([C@@H](N(C([C@H](OC([C@](N2C)([H])CC(C)C)=O)C)=O)C)CC(C)C)=O)CC3=CC=CC=C3 |
| Formula: | C52H76N4O12 |
| M.Wt: | 949.18 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | PF 1022A is a N-methylated cyclooctadepsipeptides (CODPs) with strong anthelmintic properties; acts as an ionophore.PF 1022A showed strong anthelmintic activities against Ascaridia galli in chickens [1]. PF1022A is a novel anthelmintic that binds to the latrophilin-like transmembrane receptor important for pharyngeal pumping in nematodes. Furthermore, PF1022A binds to GABA receptors, which might contribute to the anthelmintic effect. Like other cyclodepsipeptides, PF1022A acts as an ionophore [2]. In vitro, PF1022A showed low activity on embryonation but significantly inhibited egg hatch (10 and 100 μg/ml), whereas albendazole (10 and 100 μg/ml) revealed statistically significant inhibitions of both embryonation and egg hatch. PF1022A (1-100 μg/ml) completely inhibited larval movement at most examination points [3]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|