To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2864-50-8 |
| Chemical Name: | Cholesterol 3-Sulfate Sodium Salt |
| Synonyms: | Cholesteryl sodium sulfate;Sodium cholesteryl sulfate;5-Cholesten-3beta-ol sulfate sodium salt;Cholesterol-3-sulfate sodium salt;cholesterol 3-sulfate (sodium salt);Cholesterol 3-Sulfate Sodium Salt;Cholesterol Sulfate (sodium salt);5-Cholesten-3β-ol sulfate sodium salt;Cholesteryl sulfate sodium salt;cholesterol sulfonate;cholesteryl sulfate;cholesteryl sulphate;cholesterol sulfonate; cholesteryl sulfate; sodium cholesteryl sulfate; cholesteryl sulphate |
| SMILES: | O=S(O[C@H]1CC[C@]2(C)[C@@]3([H])CC[C@]4(C)[C@@H]([C@@H](CCCC(C)C)C)CC[C@@]4([H])[C@]3([H])CC=C2C1)([O-])=O.[Na+] |
| Formula: | C27H45O4S-.Na+ |
| M.Wt: | 488.6986 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |