To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2291360-73-9 |
| Chemical Name: | NVP-DKY709 |
| Synonyms: | 2,6-Piperidinedione, 3-[1,3-dihydro-1-oxo-5-[1-(phenylmethyl)-4-piperidinyl]-2H-isoindol-2-yl]-;NVP-DKY709 |
| SMILES: | N1C(=O)CCC(N2CC3=C(C2=O)C=CC(C2CCN(CC4=CC=CC=C4)CC2)=C3)C1=O |
| Formula: | C25H27N3O3 |
| M.Wt: | 417.50 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
