To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2504235-67-8 |
| Chemical Name: | Cemsidomide |
| Synonyms: | 2,6-Piperidinedione, 3-[6-[[4-(4-morpholinylmethyl)phenyl]methyl]-2-oxobenz[cd]indol-1(2H)-yl]-, (3S)-;Cemsidomide |
| SMILES: | O=C1[C@@H](N2C(=O)C3=C4C(C(CC5=CC=C(C=C5)CN5CCOCC5)=CC=C24)=CC=C3)CCC(=O)N1 |
| Formula: | C28H27N3O4 |
| M.Wt: | 469.53 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
