DC Chemicals' products qualify for U.S. tariff exemptions. We guarantee no price increases due to customs duties and maintain stable supply, continuing to deliver reliable research solutions to our American clients.
| Cas No.: | 2089314-57-6 |
| Chemical Name: | N-(2-oxo-2-((2-phenoxyphenyl)amino)ethyl)-1-naphthamide |
| Synonyms: | AOH-1160;AOH 1160 |
| SMILES: | C(C(NCC(=O)NC1=CC=CC=C1OC1=CC=CC=C1)=O)1=C2C(C=CC=C2)=CC=C1 |
| Formula: | C25H20N2O3 |
| M.Wt: | 396.446 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | AOH1160 is a potent, first-in-class, orally available small molecule inhibitor of Proliferating cell nuclear antigen (PCNA); selectively kills many types of cancer cells at below micromolar concentrations (mean GI50=330 nM) without causing significant toxicity to a broad range of non-malignant cells, interferes with DNA replication, blocks homologous recombination-mediated DNA repair, and causes cell cycle arrest; suppresses tumor growth without causing significant side effects in mice, demostrates the potential as a broad-spectrum therapeutic agent for cancer treatment. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|