To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2438124-95-7 |
| Chemical Name: | ALV2 |
| Synonyms: | Urea, N-(3-chloro-4-methylphenyl)-N'-[1-[3-[[1-(2,6-dioxo-3-piperidinyl)-2,5-dihydro-2,5-dioxo-1H-pyrrol-3-yl]amino]phenyl]-1-methylethyl]-;ALV2 |
| SMILES: | C1=C(C=CC(C)=C1Cl)NC(=O)NC(C)(C)C1C=C(NC2C(=O)N(C3C(=O)NC(=O)CC3)C(C=2)=O)C=CC=1 |
| Formula: | C26H26ClN5O5 |
| M.Wt: | 523.97 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
