| Cas No.: | |
| Chemical Name: | ARV-T1 |
| Synonyms: | ARVT1, ARV T1 |
| SMILES: | CCCCCCCCC(CCCCCC)OC(=O)CCCCCCN(CCCCO)CCCCCC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@@]2(C)[C@H]3CC[C@@H]2[C@H](C)CCCC(C)C)C1 |
| Formula: | CsGH107NO5 |
| M.Wt: | 910.51 |
| Purity: | ELSD-HPLC>95% |
| Sotrage: | 1 year -20°C |
| Publication: | Lipid Nanoparticles Formulated with a Novel Cholesterol-Tailed Ionizable Lipid Markedly Increase mRNA Delivery Both in vitro and in vivo-Int J Nanomedicine. 2025 Jul 28:20:9389-9405. doi: 10.2147/IJN.S527822. eCollection 2025. |

To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.

