To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2367619-87-0 |
| Chemical Name: | FPFT-2216 |
| Synonyms: | 2,6-Piperidinedione, 3-[4-(4-methoxy-3-thienyl)-1H-1,2,3-triazol-1-yl]-;FPFT-2216 |
| SMILES: | N1C(=O)CCC(N2C=C(C3C(OC)=CSC=3)N=N2)C1=O |
| Formula: | C12H12N4O3S |
| M.Wt: | 292.31 |
| Purity: | 98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
