To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2864408-92-2 |
| Chemical Name: | GBD-9 |
| Synonyms: | PD173370;EX-A8456 |
| SMILES: | O=C(CCCCCCCCNC1C=CC2C(N(C(C=2C=1)=O)C1C(NC(CC1)=O)=O)=O)N1CCC[C@H](C1)N1C2C(=C(N)N=CN=2)C(C2C=CC(=CC=2)OC2C=CC=CC=2)=N1 |
| Formula: | C44H47N9O6 |
| M.Wt: | 797.90 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
