Cas No.: | 712333-04-5 |
Chemical Name: | 1-(2-Chlorophenyl)-N-[1-(1-phenylethyl)-1H-benzimidazol-5-yl]methanesulfonamide |
Synonyms: | C2BA 4 |
SMILES: | C(C1=CC=CC=C1Cl)S(NC1=CC=C2N(C(C3=CC=CC=C3)C)C=NC2=C1)(=O)=O |
Formula: | C22H20ClN3O2S |
M.Wt: | 425.931 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | C2BA-4(C2BA 4) is a potent, specific human Pregnane X receptor (hPXR) activator with EC50 of 49 nM; activates PXR specifically and more potently than SR12813, induces mRNA expression of hPXR target genes, such as CYPP450 3A4 and 2B6 in primary human hepatocytes, also induces hPXR-mediated in vivo luciferase expression in HGPXR stable bioluminescent cells implanted in mice. |