To enhance service speed and avoid tariff delays, we've opened a US warehouse. All US orders ship directly from our US facility.
| Cas No.: | 2654011-51-3 |
| Chemical Name: | 3-[6-[[(2R)-1-ethylpiperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| Synonyms: | DWIZ-2;SCHEMBL23532590;EX-A9597;2654011-51-3 |
| SMILES: | O(C1C=CC2C(N(CC=2C=1)C1C(NC(CC1)=O)=O)=O)C[C@H]1CCCCN1CC |
| Formula: | C21H27N3O4 |
| M.Wt: | 385.46 |
| Purity: | >98% |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
