Cas No.: | 136-40-3 |
SMILES: | Cl.C1(/N=N/C2=CC=C(N)N=C2N)C=CC=CC=1 |
Formula: | C11H12ClN5 |
M.Wt: | 249.7 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | Phenazopyridine Hcl is a chemical, which has a local analgesic effect, often used to alleviate the pain, irritation, discomfort, or urgency caused by urinary tract infections, surgery, or injury to the urinary tract. |