Cas No.: | 1075798-37-6 |
Chemical Name: | 4-(2-{2-(4-benzylphenyl)-2-[2-methyl-6-(piperidin-1-yl)phenyl]hydrazin-1-yl}-2-oxoethyl)-5-bromo-2-methoxybenzoic acid |
Synonyms: | BTA074;BTA-074;AP611074;AP-611074 |
SMILES: | C(O)(=O)C1=CC(Br)=C(CC(NN(C2=CC=C(CC3=CC=CC=C3)C=C2)C2=C(N3CCCCC3)C=CC=C2C)=O)C=C1OC |
Formula: | C35H36BrN3O4 |
M.Wt: | 642.594 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | A first-in-class, small molecule protein-protein inhibitor of the interaction between the E1 and E2 proteins of HPV types 6 and 11; is being evaluated as a topical treatment for genital warts, condyloma or other HPV infections. |