Cas No.: | 144707-18-6 |
Chemical Name: | 2’,3’,4’-trihydroxyflavone |
Synonyms: | 2-D 08;2D-08 |
SMILES: | O=C1C=C(C2=CC=C(O)C(O)=C2O)OC3=CC=CC=C13 |
Formula: | C15H10O5 |
M.Wt: | 270.2 |
Purity: | >98% |
Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
Description: | A cell permeable, mechanistically unique inhibitor of protein sumoylation; inhibits sumoylation by preventing transfer of SUMO from the UBC9-SUMO thioester to the substrate; exhibits efficacious anti-aggregatory and neuroprotective effect. |