| Cas No.: | 1448169-71-8 |
| Chemical Name: | 1-[(3S)-3-{4-amino-3-[(3,5-dimethoxyphenyl)ethynyl]-1H-pyrazolo[3,4-d]pyrimidin-1-yl}pyrrolidin-1-yl]prop-2-en1-one |
| Synonyms: | Futibatinib;TAS120 |
| SMILES: | C(N1CC[C@@H](N2C3C(C(C#CC4=CC(OC)=CC(OC)=C4)=N2)=C(N)N=CN=3)C1)(=O)C=C |
| Formula: | C22H22N6O3 |
| M.Wt: | 418.457 |
| Sotrage: | 2 years -20°C Powder, 2 weeks 4°C in DMSO, 6 months -80°C in DMSO |
| Description: | TAS-120 is a novel, potent and highly selective FGFR inhibitor, used for antitumor treatment. |
| In Vivo: | TAS-120 (3, 30, 100 mg/kg/day, p.o.) exerts an anti-tumor effect in mice. TAS-120 shows anti-tumor effect by administering at moderate intervals, such as intermittent administration of every other day dosing and 2 times/week, and reducing the sustained elevation and weight suppression blood phosphorus level, and take a antitumor effective as daily administration[1]. |
MSDS
COA
| LOT NO. | DOWNLOAD |
|
|
|
| 2018-0101 |
|
| 2018-0101 |
|